C16H16BrNO3S2 — CID 7013332
(2S)-3-(benzenesulfonyl)-2-(5-bromo-2-methoxyphenyl)-1,3-thiazolidine (PubChem CID 7013332) has the molecular formula C16H16BrNO3S2 and a molecular weight of 414.35 g/mol. Its IUPAC name is (2S)-3-(benzenesulfonyl)-2-(5-bromo-2-methoxyphenyl)-1,3-thiazolidine.
| Compound Name | (2S)-3-(benzenesulfonyl)-2-(5-bromo-2-methoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 7013332 |
| Molecular Formula | C16H16BrNO3S2 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | (2S)-3-(benzenesulfonyl)-2-(5-bromo-2-methoxyphenyl)-1,3-thiazolidine |
| SMILES | COc1ccc(Br)cc1[C@@H]1SCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16BrNO3S2/c1-21-15-8-7-12(17)11-14(15)16-18(9-10-22-16)23(19,20)13-5-3-2-4-6-13/h2-8,11,16H,9-10H2,1H3/t16-/m0/s1 |
| InChIKey | VGPOWWKFTNTGNK-INIZCTEOSA-N |
| XLogP | 3.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |