C22H27NO5S2 — CID 122330885
3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine (PubChem CID 122330885) has the molecular formula C22H27NO5S2 and a molecular weight of 449.59 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine.
| Compound Name | 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 122330885 |
| Molecular Formula | C22H27NO5S2 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine |
| SMILES | COc1cc(OC)c(C2SCCN2S(=O)(=O)c2ccc3c(c2)CCCC3)cc1OC |
| InChI | InChI=1S/C22H27NO5S2/c1-26-19-14-21(28-3)20(27-2)13-18(19)22-23(10-11-29-22)30(24,25)17-9-8-15-6-4-5-7-16(15)12-17/h8-9,12-14,22H,4-7,10-11H2,1-3H3 |
| InChIKey | USEXMVGGHJHLHD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |