C19H20N2O5S2 — CID 122330940
4-[[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile (PubChem CID 122330940) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile.
| Compound Name | 4-[[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 122330940 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 4-[[2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile |
| SMILES | COc1cc(OC)c(C2SCCN2S(=O)(=O)c2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C19H20N2O5S2/c1-24-16-11-18(26-3)17(25-2)10-15(16)19-21(8-9-27-19)28(22,23)14-6-4-13(12-20)5-7-14/h4-7,10-11,19H,8-9H2,1-3H3 |
| InChIKey | STQALXHEWJROFZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |