C18H17BrINO3S — CID 139091569
(2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 139091569) has the molecular formula C18H17BrINO3S and a molecular weight of 534.21 g/mol. Its IUPAC name is (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
| Compound Name | (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 139091569 |
| Molecular Formula | C18H17BrINO3S |
| Molecular Weight | 534.21 g/mol |
| Exact Mass | 532.92 |
| IUPAC Name | (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | COc1ccc([C@@H]2C(I)=C(Br)CN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H17BrINO3S/c1-12-3-9-15(10-4-12)25(22,23)21-11-16(19)17(20)18(21)13-5-7-14(24-2)8-6-13/h3-10,18H,11H2,1-2H3/t18-/m1/s1 |
| InChIKey | WJJQPBRATZUFFD-GOSISDBHSA-N |
| XLogP | 4.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|