About (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole
(2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 139091569) has the molecular formula C18H17BrINO3S
and a molecular weight of 534.21 g/mol. Its IUPAC name is (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| PubChem CID | 139091569 |
| Molecular Formula | C18H17BrINO3S |
| Molecular Weight | 534.21 g/mol |
| Exact Mass | 532.92 |
| IUPAC Name | (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | COc1ccc([C@@H]2C(I)=C(Br)CN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H17BrINO3S/c1-12-3-9-15(10-4-12)25(22,23)21-11-16(19)17(20)18(21)13-5-7-14(24-2)8-6-13/h3-10,18H,11H2,1-2H3/t18-/m1/s1 |
| InChIKey | WJJQPBRATZUFFD-GOSISDBHSA-N |
| XLogP | 4.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole?
The IUPAC name of (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (CID 139091569) is (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
What is the SMILES notation for (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole?
The canonical SMILES for (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole is COc1ccc([C@@H]2C(I)=C(Br)CN2S(=O)(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole?
The InChIKey is WJJQPBRATZUFFD-GOSISDBHSA-N. The full InChI is InChI=1S/C18H17BrINO3S/c1-12-3-9-15(10-4-12)25(22,23)21-11-16(19)17(20)18(21)13-5-7-14(24-2)8-6-13/h3-10,18H,11H2,1-2H3/t18-/m1/s1.
What are the key properties of (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole?
(2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole has a molecular weight of 534.21 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-bromo-3-iodo-2-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole is sourced from PubChem (CID 139091569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).