C21H21ClN2O2S — CID 71584227
(2S,3S)-2-(4-chlorophenyl)-3-ethyl-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine-3-carbonitrile (PubChem CID 71584227) has the molecular formula C21H21ClN2O2S and a molecular weight of 400.93 g/mol. Its IUPAC name is (2S,3S)-2-(4-chlorophenyl)-3-ethyl-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine-3-carbonitrile.
| Compound Name | (2S,3S)-2-(4-chlorophenyl)-3-ethyl-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 71584227 |
| Molecular Formula | C21H21ClN2O2S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (2S,3S)-2-(4-chlorophenyl)-3-ethyl-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine-3-carbonitrile |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)[C@@H](c2ccc(Cl)cc2)[C@]1(C#N)CC |
| InChI | InChI=1S/C21H21ClN2O2S/c1-4-21(14-23)16(3)13-24(20(21)17-7-9-18(22)10-8-17)27(25,26)19-11-5-15(2)6-12-19/h5-12,20H,3-4,13H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | ZUKCNIFXIWFOJH-SFTDATJTSA-N |
| XLogP | 4.87 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|