C19H22ClNO2S — CID 122375223
2-(4-chlorophenyl)-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 122375223) has the molecular formula C19H22ClNO2S and a molecular weight of 363.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(4-chlorophenyl)-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 122375223 |
| Molecular Formula | C19H22ClNO2S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-(4-chlorophenyl)-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)(C)CC2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H22ClNO2S/c1-14-4-10-17(11-5-14)24(22,23)21-13-19(2,3)12-18(21)15-6-8-16(20)9-7-15/h4-11,18H,12-13H2,1-3H3 |
| InChIKey | VGRXXJGCGBEJDZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |