C16H24NO4PdS- — CID 135032555
acetic acid;2-methanidyl-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine;palladium (PubChem CID 135032555) has the molecular formula C16H24NO4PdS- and a molecular weight of 432.86 g/mol. Its IUPAC name is acetic acid;2-methanidyl-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine;palladium.
| Compound Name | acetic acid;2-methanidyl-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine;palladium |
|---|---|
| PubChem CID | 135032555 |
| Molecular Formula | C16H24NO4PdS- |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | acetic acid;2-methanidyl-4,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine;palladium |
| SMILES | CC(=O)O.[CH2-]C1CC(C)(C)CN1S(=O)(=O)c1ccc(C)cc1.[Pd] |
| InChI | InChI=1S/C14H20NO2S.C2H4O2.Pd/c1-11-5-7-13(8-6-11)18(16,17)15-10-14(3,4)9-12(15)2;1-2(3)4;/h5-8,12H,2,9-10H2,1,3-4H3;1H3,(H,3,4);/q-1;; |
| InChIKey | SSCGPIQAKCUXOO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|