C42H39AuNO2PS — CID 135008281
gold(1+);2-methanidyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine;triphenylphosphane (PubChem CID 135008281) has the molecular formula C42H39AuNO2PS and a molecular weight of 849.79 g/mol. Its IUPAC name is gold(1+);2-methanidyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine;triphenylphosphane.
| Compound Name | gold(1+);2-methanidyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine;triphenylphosphane |
|---|---|
| PubChem CID | 135008281 |
| Molecular Formula | C42H39AuNO2PS |
| Molecular Weight | 849.79 g/mol |
| Exact Mass | 849.21 |
| IUPAC Name | gold(1+);2-methanidyl-1-(4-methylphenyl)sulfonyl-4,4-diphenylpyrrolidine;triphenylphosphane |
| SMILES | [Au+].[CH2-]C1CC(c2ccccc2)(c2ccccc2)CN1S(=O)(=O)c1ccc(C)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24NO2S.C18H15P.Au/c1-19-13-15-23(16-14-19)28(26,27)25-18-24(17-20(25)2,21-9-5-3-6-10-21)22-11-7-4-8-12-22;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h3-16,20H,2,17-18H2,1H3;1-15H;/q-1;;+1 |
| InChIKey | MPRDCBXFFCSCFW-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.79 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|