C28H29NO2S — CID 135007622
1-(4-methylphenyl)sulfonyl-3,3-diphenyl-2,3a,4,5,6,8a-hexahydrocyclohepta[b]pyrrole (PubChem CID 135007622) has the molecular formula C28H29NO2S and a molecular weight of 443.61 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3,3-diphenyl-2,3a,4,5,6,8a-hexahydrocyclohepta[b]pyrrole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3,3-diphenyl-2,3a,4,5,6,8a-hexahydrocyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 135007622 |
| Molecular Formula | C28H29NO2S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3,3-diphenyl-2,3a,4,5,6,8a-hexahydrocyclohepta[b]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)(c3ccccc3)C3CCCC=CC32)cc1 |
| InChI | InChI=1S/C28H29NO2S/c1-22-17-19-25(20-18-22)32(30,31)29-21-28(23-11-5-2-6-12-23,24-13-7-3-8-14-24)26-15-9-4-10-16-27(26)29/h2-3,5-8,10-14,16-20,26-27H,4,9,15,21H2,1H3 |
| InChIKey | RHUCFWKEWQPMDT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|