C20H25NO2S — CID 164678390
2,4,4-trimethyl-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine (PubChem CID 164678390) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 2,4,4-trimethyl-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine.
| Compound Name | 2,4,4-trimethyl-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 164678390 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2,4,4-trimethyl-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)(C)CC2(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO2S/c1-16-10-12-18(13-11-16)24(22,23)21-15-19(2,3)14-20(21,4)17-8-6-5-7-9-17/h5-13H,14-15H2,1-4H3 |
| InChIKey | XJNZEGXBRSYELI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |