C20H19NO4S — CID 122233237
(1R,6R)-1-methyl-3-(4-methylphenyl)sulfonyl-6-phenyl-3-azabicyclo[4.1.0]heptane-4,5-dione (PubChem CID 122233237) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is (1R,6R)-1-methyl-3-(4-methylphenyl)sulfonyl-6-phenyl-3-azabicyclo[4.1.0]heptane-4,5-dione.
| Compound Name | (1R,6R)-1-methyl-3-(4-methylphenyl)sulfonyl-6-phenyl-3-azabicyclo[4.1.0]heptane-4,5-dione |
|---|---|
| PubChem CID | 122233237 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (1R,6R)-1-methyl-3-(4-methylphenyl)sulfonyl-6-phenyl-3-azabicyclo[4.1.0]heptane-4,5-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]3(C)C[C@]3(c3ccccc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C20H19NO4S/c1-14-8-10-16(11-9-14)26(24,25)21-13-19(2)12-20(19,17(22)18(21)23)15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | BIDPGEDAJBBZSF-PMACEKPBSA-N |
| XLogP | 2.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|