C22H21NO2SSe — CID 102407362
3-methyl-1-(4-methylphenyl)sulfonyl-3-phenylselanyl-2H-indole (PubChem CID 102407362) has the molecular formula C22H21NO2SSe and a molecular weight of 442.44 g/mol. Its IUPAC name is 3-methyl-1-(4-methylphenyl)sulfonyl-3-phenylselanyl-2H-indole.
| Compound Name | 3-methyl-1-(4-methylphenyl)sulfonyl-3-phenylselanyl-2H-indole |
|---|---|
| PubChem CID | 102407362 |
| Molecular Formula | C22H21NO2SSe |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)sulfonyl-3-phenylselanyl-2H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)([Se]c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H21NO2SSe/c1-17-12-14-18(15-13-17)26(24,25)23-16-22(2,20-10-6-7-11-21(20)23)27-19-8-4-3-5-9-19/h3-15H,16H2,1-2H3 |
| InChIKey | YRKPDTRFSDTVJU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|