C27H28N2O2S — CID 15507651
1'-benzyl-5'-methylidene-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,3'-piperidine] (PubChem CID 15507651) has the molecular formula C27H28N2O2S and a molecular weight of 444.60 g/mol. Its IUPAC name is 1'-benzyl-5'-methylidene-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,3'-piperidine].
| Compound Name | 1'-benzyl-5'-methylidene-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,3'-piperidine] |
|---|---|
| PubChem CID | 15507651 |
| Molecular Formula | C27H28N2O2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1'-benzyl-5'-methylidene-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,3'-piperidine] |
| SMILES | C=C1CN(Cc2ccccc2)CC2(C1)CN(S(=O)(=O)c1ccc(C)cc1)c1ccccc12 |
| InChI | InChI=1S/C27H28N2O2S/c1-21-12-14-24(15-13-21)32(30,31)29-20-27(25-10-6-7-11-26(25)29)16-22(2)17-28(19-27)18-23-8-4-3-5-9-23/h3-15H,2,16-20H2,1H3 |
| InChIKey | DTMBKKCFRKYOGQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|