C36H38N4O4S2 — CID 177392311
(1S,2S,10S,11S)-21,24-dimethyl-3,12-bis-(4-methylphenyl)sulfonyl-3,12,21,24-tetrazahexacyclo[9.7.3.32,10.01,10.04,9.013,18]tetracosa-4,6,8,13,15,17-hexaene (PubChem CID 177392311) has the molecular formula C36H38N4O4S2 and a molecular weight of 654.86 g/mol. Its IUPAC name is (1S,2S,10S,11S)-21,24-dimethyl-3,12-bis-(4-methylphenyl)sulfonyl-3,12,21,24-tetrazahexacyclo[9.7.3.32,10.01,10.04,9.013,18]tetracosa-4,6,8,13,15,17-hexaene.
| Compound Name | (1S,2S,10S,11S)-21,24-dimethyl-3,12-bis-(4-methylphenyl)sulfonyl-3,12,21,24-tetrazahexacyclo[9.7.3.32,10.01,10.04,9.013,18]tetracosa-4,6,8,13,15,17-hexaene |
|---|---|
| PubChem CID | 177392311 |
| Molecular Formula | C36H38N4O4S2 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | (1S,2S,10S,11S)-21,24-dimethyl-3,12-bis-(4-methylphenyl)sulfonyl-3,12,21,24-tetrazahexacyclo[9.7.3.32,10.01,10.04,9.013,18]tetracosa-4,6,8,13,15,17-hexaene |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3[C@@]34CCN(C)[C@@H]2[C@]32CCN(C)[C@H]4N(S(=O)(=O)c3ccc(C)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C36H38N4O4S2/c1-25-13-17-27(18-14-25)45(41,42)39-31-11-7-5-9-29(31)36-22-23-37(3)33(39)35(36)21-24-38(4)34(36)40(32-12-8-6-10-30(32)35)46(43,44)28-19-15-26(2)16-20-28/h5-20,33-34H,21-24H2,1-4H3/t33-,34-,35+,36+/m0/s1 |
| InChIKey | JBXOTFRZJFDAJC-CLLHQPRTSA-N |
| XLogP | 5.22 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |