C23H31N3O2S — CID 177465298
3-[(1S,4aR,9aS)-1-(aminomethyl)-9-(4-methylphenyl)sulfonyl-2,3,4,9a-tetrahydro-1H-carbazol-4a-yl]propan-1-amine (PubChem CID 177465298) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is 3-[(1S,4aR,9aS)-1-(aminomethyl)-9-(4-methylphenyl)sulfonyl-2,3,4,9a-tetrahydro-1H-carbazol-4a-yl]propan-1-amine.
| Compound Name | 3-[(1S,4aR,9aS)-1-(aminomethyl)-9-(4-methylphenyl)sulfonyl-2,3,4,9a-tetrahydro-1H-carbazol-4a-yl]propan-1-amine |
|---|---|
| PubChem CID | 177465298 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-[(1S,4aR,9aS)-1-(aminomethyl)-9-(4-methylphenyl)sulfonyl-2,3,4,9a-tetrahydro-1H-carbazol-4a-yl]propan-1-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3[C@]3(CCCN)CCC[C@@H](CN)[C@H]23)cc1 |
| InChI | InChI=1S/C23H31N3O2S/c1-17-9-11-19(12-10-17)29(27,28)26-21-8-3-2-7-20(21)23(14-5-15-24)13-4-6-18(16-25)22(23)26/h2-3,7-12,18,22H,4-6,13-16,24-25H2,1H3/t18-,22-,23+/m0/s1 |
| InChIKey | JSLKDOWJECFAFR-OFAXGOBFSA-N |
| XLogP | 3.31 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |