C23H29NO3S — CID 101470145
(4aR,10aR)-8-tert-butyl-10-(4-methylphenyl)sulfonyl-1,2,3,4,4a,10a-hexahydrophenoxazine (PubChem CID 101470145) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is (4aR,10aR)-8-tert-butyl-10-(4-methylphenyl)sulfonyl-1,2,3,4,4a,10a-hexahydrophenoxazine.
| Compound Name | (4aR,10aR)-8-tert-butyl-10-(4-methylphenyl)sulfonyl-1,2,3,4,4a,10a-hexahydrophenoxazine |
|---|---|
| PubChem CID | 101470145 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (4aR,10aR)-8-tert-butyl-10-(4-methylphenyl)sulfonyl-1,2,3,4,4a,10a-hexahydrophenoxazine |
| SMILES | Cc1ccc(S(=O)(=O)N2c3cc(C(C)(C)C)ccc3O[C@@H]3CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C23H29NO3S/c1-16-9-12-18(13-10-16)28(25,26)24-19-7-5-6-8-21(19)27-22-14-11-17(15-20(22)24)23(2,3)4/h9-15,19,21H,5-8H2,1-4H3/t19-,21-/m1/s1 |
| InChIKey | SAPHKTCZSHTMDS-TZIWHRDSSA-N |
| XLogP | 5.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |