C26H27NO3S — CID 101470149
(5aR,10aR)-11-(4-methylphenyl)sulfonyl-2-phenyl-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzoxazine (PubChem CID 101470149) has the molecular formula C26H27NO3S and a molecular weight of 433.57 g/mol. Its IUPAC name is (5aR,10aR)-11-(4-methylphenyl)sulfonyl-2-phenyl-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzoxazine.
| Compound Name | (5aR,10aR)-11-(4-methylphenyl)sulfonyl-2-phenyl-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzoxazine |
|---|---|
| PubChem CID | 101470149 |
| Molecular Formula | C26H27NO3S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (5aR,10aR)-11-(4-methylphenyl)sulfonyl-2-phenyl-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzoxazine |
| SMILES | Cc1ccc(S(=O)(=O)N2c3cc(-c4ccccc4)ccc3O[C@@H]3CCCCC[C@H]32)cc1 |
| InChI | InChI=1S/C26H27NO3S/c1-19-12-15-22(16-13-19)31(28,29)27-23-10-6-3-7-11-25(23)30-26-17-14-21(18-24(26)27)20-8-4-2-5-9-20/h2,4-5,8-9,12-18,23,25H,3,6-7,10-11H2,1H3/t23-,25-/m1/s1 |
| InChIKey | DBSBZTFPFCPBOD-ILBGXUMGSA-N |
| XLogP | 5.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |