C20H24N2O2S — CID 71694756
(10bS)-6-(benzenesulfonyl)-2,9-dimethyl-1,3,4,5,5a,10b-hexahydroazepino[4,3-b]indole (PubChem CID 71694756) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is (10bS)-6-(benzenesulfonyl)-2,9-dimethyl-1,3,4,5,5a,10b-hexahydroazepino[4,3-b]indole.
| Compound Name | (10bS)-6-(benzenesulfonyl)-2,9-dimethyl-1,3,4,5,5a,10b-hexahydroazepino[4,3-b]indole |
|---|---|
| PubChem CID | 71694756 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (10bS)-6-(benzenesulfonyl)-2,9-dimethyl-1,3,4,5,5a,10b-hexahydroazepino[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C)CCCC1N2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2S/c1-15-10-11-20-17(13-15)18-14-21(2)12-6-9-19(18)22(20)25(23,24)16-7-4-3-5-8-16/h3-5,7-8,10-11,13,18-19H,6,9,12,14H2,1-2H3/t18-,19?/m1/s1 |
| InChIKey | HIMAKZRUBJKPGA-MRTLOADZSA-N |
| XLogP | 3.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |