C21H26N2 — CID 58147095
(10bR)-6-benzyl-2,9-dimethyl-1,3,4,5,5a,10b-hexahydroazepino[4,3-b]indole (PubChem CID 58147095) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (10bR)-6-benzyl-2,9-dimethyl-1,3,4,5,5a,10b-hexahydroazepino[4,3-b]indole.
| Compound Name | (10bR)-6-benzyl-2,9-dimethyl-1,3,4,5,5a,10b-hexahydroazepino[4,3-b]indole |
|---|---|
| PubChem CID | 58147095 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (10bR)-6-benzyl-2,9-dimethyl-1,3,4,5,5a,10b-hexahydroazepino[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CCCC1N2Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2/c1-16-10-11-21-18(13-16)19-15-22(2)12-6-9-20(19)23(21)14-17-7-4-3-5-8-17/h3-5,7-8,10-11,13,19-20H,6,9,12,14-15H2,1-2H3/t19-,20?/m0/s1 |
| InChIKey | DNRSHNWCUJWRFC-XJDOXCRVSA-N |
| XLogP | 4.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |