C20H22N2O — CID 58159520
1-[(3aR,8bR)-2,7-dimethyl-1,3,3a,8b-tetrahydropyrrolo[3,4-b]indol-4-yl]-2-phenylethanone (PubChem CID 58159520) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[(3aR,8bR)-2,7-dimethyl-1,3,3a,8b-tetrahydropyrrolo[3,4-b]indol-4-yl]-2-phenylethanone.
| Compound Name | 1-[(3aR,8bR)-2,7-dimethyl-1,3,3a,8b-tetrahydropyrrolo[3,4-b]indol-4-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 58159520 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-[(3aR,8bR)-2,7-dimethyl-1,3,3a,8b-tetrahydropyrrolo[3,4-b]indol-4-yl]-2-phenylethanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)C[C@@H]1N2C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O/c1-14-8-9-18-16(10-14)17-12-21(2)13-19(17)22(18)20(23)11-15-6-4-3-5-7-15/h3-10,17,19H,11-13H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | ISPPLNIDIILWFP-HKUYNNGSSA-N |
| XLogP | 2.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |