C16H19N3O — CID 125420413
3-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-oxopropanenitrile (PubChem CID 125420413) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-oxopropanenitrile.
| Compound Name | 3-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 125420413 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-oxopropanenitrile |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C)CC[C@H]1N2C(=O)CC#N |
| InChI | InChI=1S/C16H19N3O/c1-11-3-4-14-12(9-11)13-10-18(2)8-6-15(13)19(14)16(20)5-7-17/h3-4,9,13,15H,5-6,8,10H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | MELAKDZBFQQOAO-UKRRQHHQSA-N |
| XLogP | 2.04 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |