C19H27ClN2O — CID 52993501
[(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-cyclopentylmethanone;hydrochloride (PubChem CID 52993501) has the molecular formula C19H27ClN2O and a molecular weight of 334.89 g/mol. Its IUPAC name is [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-cyclopentylmethanone;hydrochloride.
| Compound Name | [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-cyclopentylmethanone;hydrochloride |
|---|---|
| PubChem CID | 52993501 |
| Molecular Formula | C19H27ClN2O |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-cyclopentylmethanone;hydrochloride |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CC[C@@H]1N2C(=O)C1CCCC1.Cl |
| InChI | InChI=1S/C19H26N2O.ClH/c1-13-7-8-17-15(11-13)16-12-20(2)10-9-18(16)21(17)19(22)14-5-3-4-6-14;/h7-8,11,14,16,18H,3-6,9-10,12H2,1-2H3;1H/t16-,18-;/m0./s1 |
| InChIKey | XPYSKLPXDIGRKN-AKXYIILFSA-N |
| XLogP | 3.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |