C17H25N3S — CID 23963667
2,8-dimethyl-N-propan-2-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide (PubChem CID 23963667) has the molecular formula C17H25N3S and a molecular weight of 303.48 g/mol. Its IUPAC name is 2,8-dimethyl-N-propan-2-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide.
| Compound Name | 2,8-dimethyl-N-propan-2-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide |
|---|---|
| PubChem CID | 23963667 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2,8-dimethyl-N-propan-2-yl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbothioamide |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=S)NC(C)C |
| InChI | InChI=1S/C17H25N3S/c1-11(2)18-17(21)20-15-6-5-12(3)9-13(15)14-10-19(4)8-7-16(14)20/h5-6,9,11,14,16H,7-8,10H2,1-4H3,(H,18,21) |
| InChIKey | JNALPKJBUXZXQG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|