C15H20N2O — CID 101138266
1-[(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]ethanone (PubChem CID 101138266) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-[(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]ethanone.
| Compound Name | 1-[(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]ethanone |
|---|---|
| PubChem CID | 101138266 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1-[(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(C)cc2[C@@H]2CN(C)CC[C@@H]21 |
| InChI | InChI=1S/C15H20N2O/c1-10-4-5-14-12(8-10)13-9-16(3)7-6-15(13)17(14)11(2)18/h4-5,8,13,15H,6-7,9H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | ONFJJOVKVXBKOS-ZFWWWQNUSA-N |
| XLogP | 2.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |