C24H30N2O — CID 25367559
[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(4-tert-butylphenyl)methanone (PubChem CID 25367559) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is [(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(4-tert-butylphenyl)methanone.
| Compound Name | [(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 25367559 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | [(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(4-tert-butylphenyl)methanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CC[C@H]1N2C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H30N2O/c1-16-6-11-21-19(14-16)20-15-25(5)13-12-22(20)26(21)23(27)17-7-9-18(10-8-17)24(2,3)4/h6-11,14,20,22H,12-13,15H2,1-5H3/t20-,22+/m0/s1 |
| InChIKey | GYKROQWGSBMGEA-RBBKRZOGSA-N |
| XLogP | 4.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |