C21H20F4N2O — CID 97204297
[(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone (PubChem CID 97204297) has the molecular formula C21H20F4N2O and a molecular weight of 392.40 g/mol. Its IUPAC name is [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 97204297 |
| Molecular Formula | C21H20F4N2O |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-[4-fluoro-3-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CC[C@@H]1N2C(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F4N2O/c1-12-3-6-18-14(9-12)15-11-26(2)8-7-19(15)27(18)20(28)13-4-5-17(22)16(10-13)21(23,24)25/h3-6,9-10,15,19H,7-8,11H2,1-2H3/t15-,19-/m0/s1 |
| InChIKey | ZFXHABJSDFWQQE-KXBFYZLASA-N |
| XLogP | 4.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |