C21H22F3N3O — CID 60609523
2,8-dimethyl-N-[2-(trifluoromethyl)phenyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide (PubChem CID 60609523) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is 2,8-dimethyl-N-[2-(trifluoromethyl)phenyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide.
| Compound Name | 2,8-dimethyl-N-[2-(trifluoromethyl)phenyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 60609523 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2,8-dimethyl-N-[2-(trifluoromethyl)phenyl]-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H22F3N3O/c1-13-7-8-18-14(11-13)15-12-26(2)10-9-19(15)27(18)20(28)25-17-6-4-3-5-16(17)21(22,23)24/h3-8,11,15,19H,9-10,12H2,1-2H3,(H,25,28) |
| InChIKey | MURFTSJAHFKRGQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |