C21H25N3O — CID 95287990
(4aR,9bS)-2,8-dimethyl-N-(3-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide (PubChem CID 95287990) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (4aR,9bS)-2,8-dimethyl-N-(3-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide.
| Compound Name | (4aR,9bS)-2,8-dimethyl-N-(3-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 95287990 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (4aR,9bS)-2,8-dimethyl-N-(3-methylphenyl)-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2c3ccc(C)cc3[C@H]3CN(C)CC[C@H]32)c1 |
| InChI | InChI=1S/C21H25N3O/c1-14-5-4-6-16(11-14)22-21(25)24-19-8-7-15(2)12-17(19)18-13-23(3)10-9-20(18)24/h4-8,11-12,18,20H,9-10,13H2,1-3H3,(H,22,25)/t18-,20-/m1/s1 |
| InChIKey | MZPWVJJAXPBTKB-UYAOXDASSA-N |
| XLogP | 4.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |