C21H25N3O2 — CID 6599387
(4aS,9bS)-N-(2-methoxyphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide (PubChem CID 6599387) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (4aS,9bS)-N-(2-methoxyphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide.
| Compound Name | (4aS,9bS)-N-(2-methoxyphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 6599387 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (4aS,9bS)-N-(2-methoxyphenyl)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1c2ccc(C)cc2[C@H]2CN(C)CC[C@@H]21 |
| InChI | InChI=1S/C21H25N3O2/c1-14-8-9-18-15(12-14)16-13-23(2)11-10-19(16)24(18)21(25)22-17-6-4-5-7-20(17)26-3/h4-9,12,16,19H,10-11,13H2,1-3H3,(H,22,25)/t16-,19+/m1/s1 |
| InChIKey | PWGMBDRLVPODKF-APWZRJJASA-N |
| XLogP | 3.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |