C27H28N2O2 — CID 11903766
[(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(2-phenylmethoxyphenyl)methanone (PubChem CID 11903766) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(2-phenylmethoxyphenyl)methanone.
| Compound Name | [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(2-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 11903766 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(2-phenylmethoxyphenyl)methanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CC[C@@H]1N2C(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H28N2O2/c1-19-12-13-24-22(16-19)23-17-28(2)15-14-25(23)29(24)27(30)21-10-6-7-11-26(21)31-18-20-8-4-3-5-9-20/h3-13,16,23,25H,14-15,17-18H2,1-2H3/t23-,25-/m0/s1 |
| InChIKey | WIIBZCBXVJHEFA-ZCYQVOJMSA-N |
| XLogP | 5.02 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |