C29H28N4O — CID 2316359
[(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(1,3-diphenylpyrazol-4-yl)methanone (PubChem CID 2316359) has the molecular formula C29H28N4O and a molecular weight of 448.57 g/mol. Its IUPAC name is [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(1,3-diphenylpyrazol-4-yl)methanone.
| Compound Name | [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(1,3-diphenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 2316359 |
| Molecular Formula | C29H28N4O |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | [(4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-(1,3-diphenylpyrazol-4-yl)methanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CC[C@@H]1N2C(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H28N4O/c1-20-13-14-26-23(17-20)24-18-31(2)16-15-27(24)33(26)29(34)25-19-32(22-11-7-4-8-12-22)30-28(25)21-9-5-3-6-10-21/h3-14,17,19,24,27H,15-16,18H2,1-2H3/t24-,27-/m0/s1 |
| InChIKey | ZLWQGNABQLEYHG-IGKIAQTJSA-N |
| XLogP | 5.30 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |