C30H30N4O2 — CID 6596816
[(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone (PubChem CID 6596816) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is [(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone.
| Compound Name | [(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 6596816 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)N2c3ccc(C)cc3[C@H]3CN(C)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C30H30N4O2/c1-20-9-14-27-24(17-20)25-18-32(2)16-15-28(25)34(27)30(35)26-19-33(22-7-5-4-6-8-22)31-29(26)21-10-12-23(36-3)13-11-21/h4-14,17,19,25,28H,15-16,18H2,1-3H3/t25-,28+/m1/s1 |
| InChIKey | CCVGPSSIPPYTFZ-NAKRPHOHSA-N |
| XLogP | 5.30 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |