C23H27N4O2+ — CID 2333598
(4-ethylpiperazin-4-ium-1-yl)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone (PubChem CID 2333598) has the molecular formula C23H27N4O2+ and a molecular weight of 391.50 g/mol. Its IUPAC name is (4-ethylpiperazin-4-ium-1-yl)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone.
| Compound Name | (4-ethylpiperazin-4-ium-1-yl)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 2333598 |
| Molecular Formula | C23H27N4O2+ |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (4-ethylpiperazin-4-ium-1-yl)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone |
| SMILES | CC[NH+]1CCN(C(=O)c2cn(-c3ccccc3)nc2-c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H26N4O2/c1-3-25-13-15-26(16-14-25)23(28)21-17-27(19-7-5-4-6-8-19)24-22(21)18-9-11-20(29-2)12-10-18/h4-12,17H,3,13-16H2,1-2H3/p+1 |
| InChIKey | YZADTUJWVTWARV-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |