C25H31N3O3S — CID 23881315
(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanone (PubChem CID 23881315) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanone.
| Compound Name | (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 23881315 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)N2c3ccc(C)cc3C3CN(C)CCC32)cc1 |
| InChI | InChI=1S/C25H31N3O3S/c1-17-6-9-19(10-7-17)32(30,31)27-13-4-5-24(27)25(29)28-22-11-8-18(2)15-20(22)21-16-26(3)14-12-23(21)28/h6-11,15,21,23-24H,4-5,12-14,16H2,1-3H3 |
| InChIKey | QTNVILPENKOOML-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |