C23H36N2O — CID 10366424
1-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]decan-1-one (PubChem CID 10366424) has the molecular formula C23H36N2O and a molecular weight of 356.55 g/mol. Its IUPAC name is 1-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]decan-1-one.
| Compound Name | 1-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]decan-1-one |
|---|---|
| PubChem CID | 10366424 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | 1-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]decan-1-one |
| SMILES | CCCCCCCCCC(=O)N1c2ccc(C)cc2[C@H]2CN(C)CC[C@H]21 |
| InChI | InChI=1S/C23H36N2O/c1-4-5-6-7-8-9-10-11-23(26)25-21-13-12-18(2)16-19(21)20-17-24(3)15-14-22(20)25/h12-13,16,20,22H,4-11,14-15,17H2,1-3H3/t20-,22-/m1/s1 |
| InChIKey | DDPJQMPWGGYLRI-IFMALSPDSA-N |
| XLogP | 5.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|