C20H24N2OS — CID 51724226
1-[(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-thiophen-3-ylpropan-1-one (PubChem CID 51724226) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-[(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-thiophen-3-ylpropan-1-one.
| Compound Name | 1-[(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 51724226 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(4aS,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-thiophen-3-ylpropan-1-one |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C)CC[C@@H]1N2C(=O)CCc1ccsc1 |
| InChI | InChI=1S/C20H24N2OS/c1-14-3-5-18-16(11-14)17-12-21(2)9-7-19(17)22(18)20(23)6-4-15-8-10-24-13-15/h3,5,8,10-11,13,17,19H,4,6-7,9,12H2,1-2H3/t17-,19+/m1/s1 |
| InChIKey | JYTAJSUWAVDRCH-MJGOQNOKSA-N |
| XLogP | 3.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |