C20H20ClF3N2O2S — CID 25442954
(4aS,9bR)-5-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 25442954) has the molecular formula C20H20ClF3N2O2S and a molecular weight of 444.91 g/mol. Its IUPAC name is (4aS,9bR)-5-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aS,9bR)-5-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 25442954 |
| Molecular Formula | C20H20ClF3N2O2S |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (4aS,9bR)-5-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)[C@@H]1CN(C)CC[C@@H]1N2S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C20H20ClF3N2O2S/c1-12-3-6-17-14(9-12)15-11-25(2)8-7-18(15)26(17)29(27,28)19-10-13(20(22,23)24)4-5-16(19)21/h3-6,9-10,15,18H,7-8,11H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | UXYGMFTYLAESNQ-YJBOKZPZSA-N |
| XLogP | 4.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |