C21H26N2O3S — CID 8777767
(4aR,9bR)-5-(2-methoxy-5-methylphenyl)sulfonyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 8777767) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is (4aR,9bR)-5-(2-methoxy-5-methylphenyl)sulfonyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-5-(2-methoxy-5-methylphenyl)sulfonyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 8777767 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (4aR,9bR)-5-(2-methoxy-5-methylphenyl)sulfonyl-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1c2ccc(C)cc2[C@@H]2CN(C)CC[C@H]21 |
| InChI | InChI=1S/C21H26N2O3S/c1-14-5-7-18-16(11-14)17-13-22(3)10-9-19(17)23(18)27(24,25)21-12-15(2)6-8-20(21)26-4/h5-8,11-12,17,19H,9-10,13H2,1-4H3/t17-,19+/m0/s1 |
| InChIKey | VPZRGOYQKYEFRK-PKOBYXMFSA-N |
| XLogP | 3.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |