C22H27N3O4S — CID 124720017
N-[3-[[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]sulfonyl]-4-methoxyphenyl]acetamide (PubChem CID 124720017) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N-[3-[[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]sulfonyl]-4-methoxyphenyl]acetamide.
| Compound Name | N-[3-[[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]sulfonyl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 124720017 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[3-[[(4aR,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]sulfonyl]-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1S(=O)(=O)N1c2ccc(C)cc2[C@@H]2CN(C)CC[C@H]21 |
| InChI | InChI=1S/C22H27N3O4S/c1-14-5-7-19-17(11-14)18-13-24(3)10-9-20(18)25(19)30(27,28)22-12-16(23-15(2)26)6-8-21(22)29-4/h5-8,11-12,18,20H,9-10,13H2,1-4H3,(H,23,26)/t18-,20+/m0/s1 |
| InChIKey | IIALHVOAKODKED-AZUAARDMSA-N |
| XLogP | 2.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |