C20H22F3N2O2S+ — CID 11928250
(4aS,9bR)-2,8-dimethyl-5-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium (PubChem CID 11928250) has the molecular formula C20H22F3N2O2S+ and a molecular weight of 411.47 g/mol. Its IUPAC name is (4aS,9bR)-2,8-dimethyl-5-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium.
| Compound Name | (4aS,9bR)-2,8-dimethyl-5-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
|---|---|
| PubChem CID | 11928250 |
| Molecular Formula | C20H22F3N2O2S+ |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (4aS,9bR)-2,8-dimethyl-5-[3-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
| SMILES | Cc1ccc2c(c1)[C@@H]1C[NH+](C)CC[C@@H]1N2S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2O2S/c1-13-6-7-18-16(10-13)17-12-24(2)9-8-19(17)25(18)28(26,27)15-5-3-4-14(11-15)20(21,22)23/h3-7,10-11,17,19H,8-9,12H2,1-2H3/p+1/t17-,19-/m0/s1 |
| InChIKey | VUYGIQSPVVCKRS-HKUYNNGSSA-O |
| XLogP | 2.59 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |