C18H22N3O2S+ — CID 4693847
2,8-dimethyl-5-pyridin-3-ylsulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium (PubChem CID 4693847) has the molecular formula C18H22N3O2S+ and a molecular weight of 344.46 g/mol. Its IUPAC name is 2,8-dimethyl-5-pyridin-3-ylsulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium.
| Compound Name | 2,8-dimethyl-5-pyridin-3-ylsulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
|---|---|
| PubChem CID | 4693847 |
| Molecular Formula | C18H22N3O2S+ |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2,8-dimethyl-5-pyridin-3-ylsulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
| SMILES | Cc1ccc2c(c1)C1C[NH+](C)CCC1N2S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-13-5-6-17-15(10-13)16-12-20(2)9-7-18(16)21(17)24(22,23)14-4-3-8-19-11-14/h3-6,8,10-11,16,18H,7,9,12H2,1-2H3/p+1 |
| InChIKey | BAIZBNFYYHPVHK-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |