C21H27N2O2S+ — CID 11928292
(4aS,9bR)-5-(2,4-dimethylphenyl)sulfonyl-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium (PubChem CID 11928292) has the molecular formula C21H27N2O2S+ and a molecular weight of 371.53 g/mol. Its IUPAC name is (4aS,9bR)-5-(2,4-dimethylphenyl)sulfonyl-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium.
| Compound Name | (4aS,9bR)-5-(2,4-dimethylphenyl)sulfonyl-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
|---|---|
| PubChem CID | 11928292 |
| Molecular Formula | C21H27N2O2S+ |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (4aS,9bR)-5-(2,4-dimethylphenyl)sulfonyl-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(C)cc3[C@@H]3C[NH+](C)CC[C@@H]32)c(C)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-14-6-8-21(16(3)11-14)26(24,25)23-19-7-5-15(2)12-17(19)18-13-22(4)10-9-20(18)23/h5-8,11-12,18,20H,9-10,13H2,1-4H3/p+1/t18-,20-/m0/s1 |
| InChIKey | XAJVXDOKUGCKEC-ICSRJNTNSA-O |
| XLogP | 2.19 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |