C18H24N3O3S+ — CID 11928356
4-[[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 11928356) has the molecular formula C18H24N3O3S+ and a molecular weight of 362.48 g/mol. Its IUPAC name is 4-[[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 11928356 |
| Molecular Formula | C18H24N3O3S+ |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1ccc2c(c1)[C@H]1C[NH+](C)CC[C@@H]1N2S(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C18H23N3O3S/c1-11-5-6-16-14(9-11)15-10-20(4)8-7-17(15)21(16)25(22,23)18-12(2)19-24-13(18)3/h5-6,9,15,17H,7-8,10H2,1-4H3/p+1/t15-,17+/m1/s1 |
| InChIKey | OTAYCLPIJIJXDE-WBVHZDCISA-O |
| XLogP | 1.18 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |