C19H20F3N2O2S+ — CID 11928306
(4aS,9bR)-2,8-dimethyl-5-(2,3,4-trifluorophenyl)sulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium (PubChem CID 11928306) has the molecular formula C19H20F3N2O2S+ and a molecular weight of 397.44 g/mol. Its IUPAC name is (4aS,9bR)-2,8-dimethyl-5-(2,3,4-trifluorophenyl)sulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium.
| Compound Name | (4aS,9bR)-2,8-dimethyl-5-(2,3,4-trifluorophenyl)sulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
|---|---|
| PubChem CID | 11928306 |
| Molecular Formula | C19H20F3N2O2S+ |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (4aS,9bR)-2,8-dimethyl-5-(2,3,4-trifluorophenyl)sulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
| SMILES | Cc1ccc2c(c1)[C@@H]1C[NH+](C)CC[C@@H]1N2S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H19F3N2O2S/c1-11-3-5-15-12(9-11)13-10-23(2)8-7-16(13)24(15)27(25,26)17-6-4-14(20)18(21)19(17)22/h3-6,9,13,16H,7-8,10H2,1-2H3/p+1/t13-,16-/m0/s1 |
| InChIKey | BGTIWOMCGTYSIU-BBRMVZONSA-O |
| XLogP | 1.99 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|