C19H21Cl2N2O2S+ — CID 11928302
(4aS,9bR)-5-(2,6-dichlorophenyl)sulfonyl-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium (PubChem CID 11928302) has the molecular formula C19H21Cl2N2O2S+ and a molecular weight of 412.36 g/mol. Its IUPAC name is (4aS,9bR)-5-(2,6-dichlorophenyl)sulfonyl-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium.
| Compound Name | (4aS,9bR)-5-(2,6-dichlorophenyl)sulfonyl-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
|---|---|
| PubChem CID | 11928302 |
| Molecular Formula | C19H21Cl2N2O2S+ |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (4aS,9bR)-5-(2,6-dichlorophenyl)sulfonyl-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
| SMILES | Cc1ccc2c(c1)[C@@H]1C[NH+](C)CC[C@@H]1N2S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O2S/c1-12-6-7-17-13(10-12)14-11-22(2)9-8-18(14)23(17)26(24,25)19-15(20)4-3-5-16(19)21/h3-7,10,14,18H,8-9,11H2,1-2H3/p+1/t14-,18-/m0/s1 |
| InChIKey | JSFJCDYQQWZOTR-KSSFIOAISA-O |
| XLogP | 2.88 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |