C17H21N2O2S2+ — CID 11945110
(4aS,9bR)-2,8-dimethyl-5-thiophen-2-ylsulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium (PubChem CID 11945110) has the molecular formula C17H21N2O2S2+ and a molecular weight of 349.50 g/mol. Its IUPAC name is (4aS,9bR)-2,8-dimethyl-5-thiophen-2-ylsulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium.
| Compound Name | (4aS,9bR)-2,8-dimethyl-5-thiophen-2-ylsulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
|---|---|
| PubChem CID | 11945110 |
| Molecular Formula | C17H21N2O2S2+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (4aS,9bR)-2,8-dimethyl-5-thiophen-2-ylsulfonyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium |
| SMILES | Cc1ccc2c(c1)[C@@H]1C[NH+](C)CC[C@@H]1N2S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H20N2O2S2/c1-12-5-6-15-13(10-12)14-11-18(2)8-7-16(14)19(15)23(20,21)17-4-3-9-22-17/h3-6,9-10,14,16H,7-8,11H2,1-2H3/p+1/t14-,16-/m0/s1 |
| InChIKey | MGXPVVFHFUKZFH-HOCLYGCPSA-O |
| XLogP | 1.64 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |