C21H23F3N3O+ — CID 2476790
(4aS,9bR)-2,8-dimethyl-N-[3-(trifluoromethyl)phenyl]-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carboxamide (PubChem CID 2476790) has the molecular formula C21H23F3N3O+ and a molecular weight of 390.43 g/mol. Its IUPAC name is (4aS,9bR)-2,8-dimethyl-N-[3-(trifluoromethyl)phenyl]-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carboxamide.
| Compound Name | (4aS,9bR)-2,8-dimethyl-N-[3-(trifluoromethyl)phenyl]-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carboxamide |
|---|---|
| PubChem CID | 2476790 |
| Molecular Formula | C21H23F3N3O+ |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (4aS,9bR)-2,8-dimethyl-N-[3-(trifluoromethyl)phenyl]-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carboxamide |
| SMILES | Cc1ccc2c(c1)[C@@H]1C[NH+](C)CC[C@@H]1N2C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N3O/c1-13-6-7-18-16(10-13)17-12-26(2)9-8-19(17)27(18)20(28)25-15-5-3-4-14(11-15)21(22,23)24/h3-7,10-11,17,19H,8-9,12H2,1-2H3,(H,25,28)/p+1/t17-,19-/m0/s1 |
| InChIKey | AUTUDPBMJAOGQU-HKUYNNGSSA-O |
| XLogP | 3.44 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |