C20H24N3S+ — CID 11860583
(4aS,9bR)-2,8-dimethyl-N-phenyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbothioamide (PubChem CID 11860583) has the molecular formula C20H24N3S+ and a molecular weight of 338.50 g/mol. Its IUPAC name is (4aS,9bR)-2,8-dimethyl-N-phenyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbothioamide.
| Compound Name | (4aS,9bR)-2,8-dimethyl-N-phenyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbothioamide |
|---|---|
| PubChem CID | 11860583 |
| Molecular Formula | C20H24N3S+ |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (4aS,9bR)-2,8-dimethyl-N-phenyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbothioamide |
| SMILES | Cc1ccc2c(c1)[C@@H]1C[NH+](C)CC[C@@H]1N2C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C20H23N3S/c1-14-8-9-18-16(12-14)17-13-22(2)11-10-19(17)23(18)20(24)21-15-6-4-3-5-7-15/h3-9,12,17,19H,10-11,13H2,1-2H3,(H,21,24)/p+1/t17-,19-/m0/s1 |
| InChIKey | ZFZIIGPUWLXOFS-HKUYNNGSSA-O |
| XLogP | 2.58 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|