C22H27N2O2+ — CID 7039658
[(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(4-ethoxyphenyl)methanone (PubChem CID 7039658) has the molecular formula C22H27N2O2+ and a molecular weight of 351.47 g/mol. Its IUPAC name is [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(4-ethoxyphenyl)methanone.
| Compound Name | [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 7039658 |
| Molecular Formula | C22H27N2O2+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | [(4aS,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-yl]-(4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)N2c3ccc(C)cc3[C@H]3C[NH+](C)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-4-26-17-8-6-16(7-9-17)22(25)24-20-10-5-15(2)13-18(20)19-14-23(3)12-11-21(19)24/h5-10,13,19,21H,4,11-12,14H2,1-3H3/p+1/t19-,21+/m1/s1 |
| InChIKey | UDJCJDFCXCKPIX-CTNGQTDRSA-O |
| XLogP | 2.42 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |