C22H28N3O3S+ — CID 2332096
3-[(4aR,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbonyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 2332096) has the molecular formula C22H28N3O3S+ and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-[(4aR,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbonyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[(4aR,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbonyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2332096 |
| Molecular Formula | C22H28N3O3S+ |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 3-[(4aR,9bS)-2,8-dimethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbonyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc2c(c1)[C@H]1C[NH+](C)CC[C@H]1N2C(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H27N3O3S/c1-15-8-9-20-18(12-15)19-14-24(4)11-10-21(19)25(20)22(26)16-6-5-7-17(13-16)29(27,28)23(2)3/h5-9,12-13,19,21H,10-11,14H2,1-4H3/p+1/t19-,21-/m1/s1 |
| InChIKey | ZOPZNBBJXXJODP-TZIWHRDSSA-O |
| XLogP | 1.28 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |